C28H30ClN3O4 — CID 156563237
tert-butyl (3S)-3-[[6-(benzhydrylideneamino)-4-chloro-3-methoxy-2-pyridinyl]oxy]pyrrolidine-1-carboxylate (PubChem CID 156563237) has the molecular formula C28H30ClN3O4 and a molecular weight of 508.02 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[6-(benzhydrylideneamino)-4-chloro-3-methoxy-2-pyridinyl]oxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[6-(benzhydrylideneamino)-4-chloro-3-methoxy-2-pyridinyl]oxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156563237 |
| Molecular Formula | C28H30ClN3O4 |
| Molecular Weight | 508.02 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | tert-butyl (3S)-3-[[6-(benzhydrylideneamino)-4-chloro-3-methoxy-2-pyridinyl]oxy]pyrrolidine-1-carboxylate |
| SMILES | COc1c(Cl)cc(N=C(c2ccccc2)c2ccccc2)nc1O[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C28H30ClN3O4/c1-28(2,3)36-27(33)32-16-15-21(18-32)35-26-25(34-4)22(29)17-23(31-26)30-24(19-11-7-5-8-12-19)20-13-9-6-10-14-20/h5-14,17,21H,15-16,18H2,1-4H3/t21-/m0/s1 |
| InChIKey | KCWTYRNPDVVDEJ-NRFANRHFSA-N |
| XLogP | 6.30 |
| TPSA | 73.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.02 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|