C19H20FN3O3 — CID 90387435
tert-butyl (3S)-3-(3-cyano-8-fluoroisoquinolin-1-yl)oxypyrrolidine-1-carboxylate (PubChem CID 90387435) has the molecular formula C19H20FN3O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is tert-butyl (3S)-3-(3-cyano-8-fluoroisoquinolin-1-yl)oxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(3-cyano-8-fluoroisoquinolin-1-yl)oxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 90387435 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | tert-butyl (3S)-3-(3-cyano-8-fluoroisoquinolin-1-yl)oxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](Oc2nc(C#N)cc3cccc(F)c23)C1 |
| InChI | InChI=1S/C19H20FN3O3/c1-19(2,3)26-18(24)23-8-7-14(11-23)25-17-16-12(5-4-6-15(16)20)9-13(10-21)22-17/h4-6,9,14H,7-8,11H2,1-3H3/t14-/m0/s1 |
| InChIKey | KSSPYSKFPMRNHR-AWEZNQCLSA-N |
| XLogP | 3.63 |
| TPSA | 75.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |