C30H33N3O2 — CID 140788041
tert-butyl (11bR)-9-(benzhydrylideneamino)-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline-2-carboxylate (PubChem CID 140788041) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is tert-butyl (11bR)-9-(benzhydrylideneamino)-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline-2-carboxylate.
| Compound Name | tert-butyl (11bR)-9-(benzhydrylideneamino)-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 140788041 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | tert-butyl (11bR)-9-(benzhydrylideneamino)-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2CCc3cc(N=C(c4ccccc4)c4ccccc4)ccc3[C@@H]2C1 |
| InChI | InChI=1S/C30H33N3O2/c1-30(2,3)35-29(34)33-19-18-32-17-16-24-20-25(14-15-26(24)27(32)21-33)31-28(22-10-6-4-7-11-22)23-12-8-5-9-13-23/h4-15,20,27H,16-19,21H2,1-3H3/t27-/m0/s1 |
| InChIKey | AKMZEUXQIWLZBR-MHZLTWQESA-N |
| XLogP | 6.01 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|