C41H42N2O2Si — CID 168876654
7-(benzhydrylideneamino)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,5-dihydro-1H-3-benzazepin-4-one (PubChem CID 168876654) has the molecular formula C41H42N2O2Si and a molecular weight of 622.89 g/mol. Its IUPAC name is 7-(benzhydrylideneamino)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,5-dihydro-1H-3-benzazepin-4-one.
| Compound Name | 7-(benzhydrylideneamino)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,5-dihydro-1H-3-benzazepin-4-one |
|---|---|
| PubChem CID | 168876654 |
| Molecular Formula | C41H42N2O2Si |
| Molecular Weight | 622.89 g/mol |
| Exact Mass | 622.30 |
| IUPAC Name | 7-(benzhydrylideneamino)-3-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2,5-dihydro-1H-3-benzazepin-4-one |
| SMILES | CC(C)(C)[Si](OCCN1CCc2ccc(N=C(c3ccccc3)c3ccccc3)cc2CC1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H42N2O2Si/c1-41(2,3)46(37-20-12-6-13-21-37,38-22-14-7-15-23-38)45-29-28-43-27-26-32-24-25-36(30-35(32)31-39(43)44)42-40(33-16-8-4-9-17-33)34-18-10-5-11-19-34/h4-25,30H,26-29,31H2,1-3H3 |
| InChIKey | BNXOMTMWBWLSEM-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.89 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|