C34H37BrN2O7Si — CID 10676150
2-[2-(2-bromoethoxy)ethyl]-6-[2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 10676150) has the molecular formula C34H37BrN2O7Si and a molecular weight of 693.67 g/mol. Its IUPAC name is 2-[2-(2-bromoethoxy)ethyl]-6-[2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-[2-(2-bromoethoxy)ethyl]-6-[2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 10676150 |
| Molecular Formula | C34H37BrN2O7Si |
| Molecular Weight | 693.67 g/mol |
| Exact Mass | 692.16 |
| IUPAC Name | 2-[2-(2-bromoethoxy)ethyl]-6-[2-[2-[tert-butyl(diphenyl)silyl]oxyethoxy]ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CC(C)(C)[Si](OCCOCCn1c(=O)c2cc3c(=O)n(CCOCCBr)c(=O)c3cc2c1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H37BrN2O7Si/c1-34(2,3)45(24-10-6-4-7-11-24,25-12-8-5-9-13-25)44-21-20-43-19-16-37-32(40)28-22-26-27(23-29(28)33(37)41)31(39)36(30(26)38)15-18-42-17-14-35/h4-13,22-23H,14-21H2,1-3H3 |
| InChIKey | UARNVGHZPMQNEF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 105.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.67 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|