C29H30N2O2 — CID 166035748
tert-butyl (3E)-3-[[4-(benzhydrylideneamino)phenyl]methylidene]pyrrolidine-1-carboxylate (PubChem CID 166035748) has the molecular formula C29H30N2O2 and a molecular weight of 438.57 g/mol. Its IUPAC name is tert-butyl (3E)-3-[[4-(benzhydrylideneamino)phenyl]methylidene]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3E)-3-[[4-(benzhydrylideneamino)phenyl]methylidene]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 166035748 |
| Molecular Formula | C29H30N2O2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | tert-butyl (3E)-3-[[4-(benzhydrylideneamino)phenyl]methylidene]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC/C(=C\c2ccc(N=C(c3ccccc3)c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C29H30N2O2/c1-29(2,3)33-28(32)31-19-18-23(21-31)20-22-14-16-26(17-15-22)30-27(24-10-6-4-7-11-24)25-12-8-5-9-13-25/h4-17,20H,18-19,21H2,1-3H3/b23-20+ |
| InChIKey | NEFXKUTWAGVWLN-BSYVCWPDSA-N |
| XLogP | 6.88 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|