C18H21FN2O2 — CID 23067976
tert-butyl 4-[(4-cyano-3-fluorophenyl)methylidene]piperidine-1-carboxylate (PubChem CID 23067976) has the molecular formula C18H21FN2O2 and a molecular weight of 316.38 g/mol. Its IUPAC name is tert-butyl 4-[(4-cyano-3-fluorophenyl)methylidene]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-cyano-3-fluorophenyl)methylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23067976 |
| Molecular Formula | C18H21FN2O2 |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | tert-butyl 4-[(4-cyano-3-fluorophenyl)methylidene]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=Cc2ccc(C#N)c(F)c2)CC1 |
| InChI | InChI=1S/C18H21FN2O2/c1-18(2,3)23-17(22)21-8-6-13(7-9-21)10-14-4-5-15(12-20)16(19)11-14/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | MYHUUBBOWADQKH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |