About Tert-butyl 4-(3-(4-(2,2,2-trifluoroethoxy)phenoxy)benzylidene)piperidine-1-carboxylate
Tert-butyl 4-(3-(4-(2,2,2-trifluoroethoxy)phenoxy)benzylidene)piperidine-1-carboxylate (PubChem CID 66876113) has the molecular formula C25H28F3NO4
and a molecular weight of 463.50 g/mol. Its IUPAC name is tert-butyl 4-[[3-[4-(2,2,2-trifluoroethoxy)phenoxy]phenyl]methylidene]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | Tert-butyl 4-(3-(4-(2,2,2-trifluoroethoxy)phenoxy)benzylidene)piperidine-1-carboxylate |
| PubChem CID | 66876113 |
| Molecular Formula | C25H28F3NO4 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | tert-butyl 4-[[3-[4-(2,2,2-trifluoroethoxy)phenoxy]phenyl]methylidene]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=CC2=CC(=CC=C2)OC3=CC=C(C=C3)OCC(F)(F)F)CC1 |
| InChI | InChI=1S/C25H28F3NO4/c1-24(2,3)33-23(30)29-13-11-18(12-14-29)15-19-5-4-6-22(16-19)32-21-9-7-20(8-10-21)31-17-25(26,27)28/h4-10,15-16H,11-14,17H2,1-3H3 |
| InChIKey | TTXTVHOUKIRZBU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | 656 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze Tert-butyl 4-(3-(4-(2,2,2-trifluoroethoxy)phenoxy)benzylidene)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tert-butyl 4-(3-(4-(2,2,2-trifluoroethoxy)phenoxy)benzylidene)piperidine-1-carboxylate?
The IUPAC name of Tert-butyl 4-(3-(4-(2,2,2-trifluoroethoxy)phenoxy)benzylidene)piperidine-1-carboxylate (CID 66876113) is tert-butyl 4-[[3-[4-(2,2,2-trifluoroethoxy)phenoxy]phenyl]methylidene]piperidine-1-carboxylate.
What is the SMILES notation for Tert-butyl 4-(3-(4-(2,2,2-trifluoroethoxy)phenoxy)benzylidene)piperidine-1-carboxylate?
The canonical SMILES for Tert-butyl 4-(3-(4-(2,2,2-trifluoroethoxy)phenoxy)benzylidene)piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC(=CC2=CC(=CC=C2)OC3=CC=C(C=C3)OCC(F)(F)F)CC1.
What is the InChIKey of Tert-butyl 4-(3-(4-(2,2,2-trifluoroethoxy)phenoxy)benzylidene)piperidine-1-carboxylate?
The InChIKey is TTXTVHOUKIRZBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28F3NO4/c1-24(2,3)33-23(30)29-13-11-18(12-14-29)15-19-5-4-6-22(16-19)32-21-9-7-20(8-10-21)31-17-25(26,27)28/h4-10,15-16H,11-14,17H2,1-3H3.
What are the key properties of Tert-butyl 4-(3-(4-(2,2,2-trifluoroethoxy)phenoxy)benzylidene)piperidine-1-carboxylate?
Tert-butyl 4-(3-(4-(2,2,2-trifluoroethoxy)phenoxy)benzylidene)piperidine-1-carboxylate has a molecular weight of 463.50 g/mol, XLogP of 6.00, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Tert-butyl 4-(3-(4-(2,2,2-trifluoroethoxy)phenoxy)benzylidene)piperidine-1-carboxylate is sourced from PubChem (CID 66876113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).