C16H18F3NO2 — CID 68851855
tert-butyl 3-[[2-(trifluoromethyl)phenyl]methylidene]azetidine-1-carboxylate (PubChem CID 68851855) has the molecular formula C16H18F3NO2 and a molecular weight of 313.32 g/mol. Its IUPAC name is tert-butyl 3-[[2-(trifluoromethyl)phenyl]methylidene]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-(trifluoromethyl)phenyl]methylidene]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 68851855 |
| Molecular Formula | C16H18F3NO2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | tert-butyl 3-[[2-(trifluoromethyl)phenyl]methylidene]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(=Cc2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C16H18F3NO2/c1-15(2,3)22-14(21)20-9-11(10-20)8-12-6-4-5-7-13(12)16(17,18)19/h4-8H,9-10H2,1-3H3 |
| InChIKey | QRKQWVYATUUZHJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |