C29H31NO2S — CID 139757516
tert-butyl 3-(tritylsulfanylmethylidene)pyrrolidine-1-carboxylate (PubChem CID 139757516) has the molecular formula C29H31NO2S and a molecular weight of 457.64 g/mol. Its IUPAC name is tert-butyl 3-(tritylsulfanylmethylidene)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(tritylsulfanylmethylidene)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139757516 |
| Molecular Formula | C29H31NO2S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | tert-butyl 3-(tritylsulfanylmethylidene)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=CSC(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C29H31NO2S/c1-28(2,3)32-27(31)30-20-19-23(21-30)22-33-29(24-13-7-4-8-14-24,25-15-9-5-10-16-25)26-17-11-6-12-18-26/h4-18,22H,19-21H2,1-3H3 |
| InChIKey | PCLLKCIRHNGCDU-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|