C28H35N3O2SSi — CID 22243029
[2-[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]-1,3-thiazol-4-yl]-piperidin-1-ylmethanone (PubChem CID 22243029) has the molecular formula C28H35N3O2SSi and a molecular weight of 505.76 g/mol. Its IUPAC name is [2-[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]-1,3-thiazol-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [2-[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]-1,3-thiazol-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 22243029 |
| Molecular Formula | C28H35N3O2SSi |
| Molecular Weight | 505.76 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | [2-[3-[tert-butyl(diphenyl)silyl]oxyazetidin-1-yl]-1,3-thiazol-4-yl]-piperidin-1-ylmethanone |
| SMILES | CC(C)(C)[Si](OC1CN(c2nc(C(=O)N3CCCCC3)cs2)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H35N3O2SSi/c1-28(2,3)35(23-13-7-4-8-14-23,24-15-9-5-10-16-24)33-22-19-31(20-22)27-29-25(21-34-27)26(32)30-17-11-6-12-18-30/h4-5,7-10,13-16,21-22H,6,11-12,17-20H2,1-3H3 |
| InChIKey | NTRGTBNYXNHYLQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.76 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|