C11H15NO2 — CID 130523178
2-(1-phenylethyl)-1,2-oxazolidin-4-ol (PubChem CID 130523178) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 2-(1-phenylethyl)-1,2-oxazolidin-4-ol.
| Compound Name | 2-(1-phenylethyl)-1,2-oxazolidin-4-ol |
|---|---|
| PubChem CID | 130523178 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 2-(1-phenylethyl)-1,2-oxazolidin-4-ol |
| SMILES | CC(c1ccccc1)N1CC(O)CO1 |
| InChI | InChI=1S/C11H15NO2/c1-9(10-5-3-2-4-6-10)12-7-11(13)8-14-12/h2-6,9,11,13H,7-8H2,1H3 |
| InChIKey | IGADNUWPMZEKME-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |