C12H16N2 — CID 70489579
2-methyl-1-(1-phenylethyl)-4,5-dihydroimidazole (PubChem CID 70489579) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-methyl-1-(1-phenylethyl)-4,5-dihydroimidazole.
| Compound Name | 2-methyl-1-(1-phenylethyl)-4,5-dihydroimidazole |
|---|---|
| PubChem CID | 70489579 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-methyl-1-(1-phenylethyl)-4,5-dihydroimidazole |
| SMILES | CC1=NCCN1C(C)c1ccccc1 |
| InChI | InChI=1S/C12H16N2/c1-10(12-6-4-3-5-7-12)14-9-8-13-11(14)2/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | XDEZCVHLRCWLCZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |