C23H28N2 — CID 15402473
6-benzyl-1-[(1S)-1-phenylethyl]-2,3,4,5,7,8-hexahydro-1,6-naphthyridine (PubChem CID 15402473) has the molecular formula C23H28N2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 6-benzyl-1-[(1S)-1-phenylethyl]-2,3,4,5,7,8-hexahydro-1,6-naphthyridine.
| Compound Name | 6-benzyl-1-[(1S)-1-phenylethyl]-2,3,4,5,7,8-hexahydro-1,6-naphthyridine |
|---|---|
| PubChem CID | 15402473 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 6-benzyl-1-[(1S)-1-phenylethyl]-2,3,4,5,7,8-hexahydro-1,6-naphthyridine |
| SMILES | C[C@@H](c1ccccc1)N1CCCC2=C1CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C23H28N2/c1-19(21-11-6-3-7-12-21)25-15-8-13-22-18-24(16-14-23(22)25)17-20-9-4-2-5-10-20/h2-7,9-12,19H,8,13-18H2,1H3/t19-/m0/s1 |
| InChIKey | ADBBIBFYBLSTGB-IBGZPJMESA-N |
| XLogP | 5.00 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |