C13H17NO2 — CID 118420929
(3S)-3-(hydroxymethyl)-1-[(1R)-1-phenylethyl]pyrrolidin-2-one (PubChem CID 118420929) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (3S)-3-(hydroxymethyl)-1-[(1R)-1-phenylethyl]pyrrolidin-2-one.
| Compound Name | (3S)-3-(hydroxymethyl)-1-[(1R)-1-phenylethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 118420929 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (3S)-3-(hydroxymethyl)-1-[(1R)-1-phenylethyl]pyrrolidin-2-one |
| SMILES | C[C@H](c1ccccc1)N1CC[C@@H](CO)C1=O |
| InChI | InChI=1S/C13H17NO2/c1-10(11-5-3-2-4-6-11)14-8-7-12(9-15)13(14)16/h2-6,10,12,15H,7-9H2,1H3/t10-,12+/m1/s1 |
| InChIKey | XSMFYCBVFDPICQ-PWSUYJOCSA-N |
| XLogP | 1.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |