C15H19NO2 — CID 163433479
3-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]propanal (PubChem CID 163433479) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 3-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]propanal.
| Compound Name | 3-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]propanal |
|---|---|
| PubChem CID | 163433479 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 3-[5-oxo-1-(1-phenylethyl)pyrrolidin-3-yl]propanal |
| SMILES | CC(c1ccccc1)N1CC(CCC=O)CC1=O |
| InChI | InChI=1S/C15H19NO2/c1-12(14-7-3-2-4-8-14)16-11-13(6-5-9-17)10-15(16)18/h2-4,7-9,12-13H,5-6,10-11H2,1H3 |
| InChIKey | ASLPYGMDYHLOKC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|