C18H21NO2 — CID 10401578
(1R,2S,6R,7S)-2-methyl-4-[(1S)-1-phenylethyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 10401578) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (1R,2S,6R,7S)-2-methyl-4-[(1S)-1-phenylethyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (1R,2S,6R,7S)-2-methyl-4-[(1S)-1-phenylethyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 10401578 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (1R,2S,6R,7S)-2-methyl-4-[(1S)-1-phenylethyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | C[C@@H](c1ccccc1)N1C(=O)[C@@H]2[C@H]3CC[C@H](C3)[C@]2(C)C1=O |
| InChI | InChI=1S/C18H21NO2/c1-11(12-6-4-3-5-7-12)19-16(20)15-13-8-9-14(10-13)18(15,2)17(19)21/h3-7,11,13-15H,8-10H2,1-2H3/t11-,13-,14+,15-,18-/m0/s1 |
| InChIKey | WLBCHUNCXOBKIH-HMZURLEKSA-N |
| XLogP | 3.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|