C29H30F3N3O9S — CID 149253390
(4-nitrophenyl)methyl 2-[2-(3-ethoxy-3-oxopropyl)sulfanyl-4-oxo-3-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]azetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 149253390) has the molecular formula C29H30F3N3O9S and a molecular weight of 653.63 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-[2-(3-ethoxy-3-oxopropyl)sulfanyl-4-oxo-3-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]azetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | (4-nitrophenyl)methyl 2-[2-(3-ethoxy-3-oxopropyl)sulfanyl-4-oxo-3-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]azetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 149253390 |
| Molecular Formula | C29H30F3N3O9S |
| Molecular Weight | 653.63 g/mol |
| Exact Mass | 653.17 |
| IUPAC Name | (4-nitrophenyl)methyl 2-[2-(3-ethoxy-3-oxopropyl)sulfanyl-4-oxo-3-[[2-[3-(trifluoromethyl)phenoxy]acetyl]amino]azetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)C(C(=O)OCc1ccc([N+](=O)[O-])cc1)N1C(=O)C(NC(=O)COc2cccc(C(F)(F)F)c2)C1SCCC(=O)OCC |
| InChI | InChI=1S/C29H30F3N3O9S/c1-4-42-23(37)12-13-45-27-24(33-22(36)16-43-21-7-5-6-19(14-21)29(30,31)32)26(38)34(27)25(17(2)3)28(39)44-15-18-8-10-20(11-9-18)35(40)41/h5-11,14,24-25,27H,2,4,12-13,15-16H2,1,3H3,(H,33,36) |
| InChIKey | RXRFGFYGQANDGJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.63 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|