C26H27N3O9S — CID 149253406
(4-nitrophenyl)methyl (6R)-3-methylidene-5,8-dioxo-7-[[2-(4-propan-2-yloxyphenoxy)acetyl]amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 149253406) has the molecular formula C26H27N3O9S and a molecular weight of 557.58 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6R)-3-methylidene-5,8-dioxo-7-[[2-(4-propan-2-yloxyphenoxy)acetyl]amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6R)-3-methylidene-5,8-dioxo-7-[[2-(4-propan-2-yloxyphenoxy)acetyl]amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 149253406 |
| Molecular Formula | C26H27N3O9S |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | (4-nitrophenyl)methyl (6R)-3-methylidene-5,8-dioxo-7-[[2-(4-propan-2-yloxyphenoxy)acetyl]amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | C=C1CS(=O)[C@@H]2C(NC(=O)COc3ccc(OC(C)C)cc3)C(=O)N2C1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H27N3O9S/c1-15(2)38-20-10-8-19(9-11-20)36-13-21(30)27-22-24(31)28-23(16(3)14-39(35)25(22)28)26(32)37-12-17-4-6-18(7-5-17)29(33)34/h4-11,15,22-23,25H,3,12-14H2,1-2H3,(H,27,30)/t22?,23?,25-,39?/m1/s1 |
| InChIKey | AYAMYCKDQWWLIS-QPVYQXTISA-N |
| XLogP | 1.84 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|