C21H19N3O7S2 — CID 22798027
(4-nitrophenyl)methyl (6S)-3-methylidene-5,8-dioxo-7-[(2-thiophen-2-ylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 22798027) has the molecular formula C21H19N3O7S2 and a molecular weight of 489.53 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (6S)-3-methylidene-5,8-dioxo-7-[(2-thiophen-2-ylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (6S)-3-methylidene-5,8-dioxo-7-[(2-thiophen-2-ylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 22798027 |
| Molecular Formula | C21H19N3O7S2 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | (4-nitrophenyl)methyl (6S)-3-methylidene-5,8-dioxo-7-[(2-thiophen-2-ylacetyl)amino]-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | C=C1CS(=O)[C@H]2C(NC(=O)Cc3cccs3)C(=O)N2C1C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H19N3O7S2/c1-12-11-33(30)20-17(22-16(25)9-15-3-2-8-32-15)19(26)23(20)18(12)21(27)31-10-13-4-6-14(7-5-13)24(28)29/h2-8,17-18,20H,1,9-11H2,(H,22,25)/t17?,18?,20-,33?/m0/s1 |
| InChIKey | GBGKLQUBXBEBME-RZXUOGCXSA-N |
| XLogP | 1.28 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|