C21H18BrN3O8S2 — CID 88823826
(4-nitrophenyl)methyl 4-bromo-2-[2-formylsulfanyl-4-oxo-3-[(2-thiophen-2-ylacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate (PubChem CID 88823826) has the molecular formula C21H18BrN3O8S2 and a molecular weight of 584.43 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-bromo-2-[2-formylsulfanyl-4-oxo-3-[(2-thiophen-2-ylacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate.
| Compound Name | (4-nitrophenyl)methyl 4-bromo-2-[2-formylsulfanyl-4-oxo-3-[(2-thiophen-2-ylacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 88823826 |
| Molecular Formula | C21H18BrN3O8S2 |
| Molecular Weight | 584.43 g/mol |
| Exact Mass | 582.97 |
| IUPAC Name | (4-nitrophenyl)methyl 4-bromo-2-[2-formylsulfanyl-4-oxo-3-[(2-thiophen-2-ylacetyl)amino]azetidin-1-yl]-3-hydroxybut-2-enoate |
| SMILES | O=CSC1C(NC(=O)Cc2cccs2)C(=O)N1C(C(=O)OCc1ccc([N+](=O)[O-])cc1)=C(O)CBr |
| InChI | InChI=1S/C21H18BrN3O8S2/c22-9-15(27)18(21(30)33-10-12-3-5-13(6-4-12)25(31)32)24-19(29)17(20(24)35-11-26)23-16(28)8-14-2-1-7-34-14/h1-7,11,17,20,27H,8-10H2,(H,23,28) |
| InChIKey | ZIKSEYZVVHATLA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 156.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|