C28H23N3O6S — CID 70578525
(4-methoxyphenyl)methyl (6R,7R)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-3-phenyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70578525) has the molecular formula C28H23N3O6S and a molecular weight of 529.57 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (6R,7R)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-3-phenyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (6R,7R)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-3-phenyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70578525 |
| Molecular Formula | C28H23N3O6S |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.13 |
| IUPAC Name | (4-methoxyphenyl)methyl (6R,7R)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-3-phenyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COc1ccc(COC(=O)C2=C(c3ccccc3)CS[C@@H]3[C@H](/N=C/c4ccc([N+](=O)[O-])cc4)C(=O)N23)cc1 |
| InChI | InChI=1S/C28H23N3O6S/c1-36-22-13-9-19(10-14-22)16-37-28(33)25-23(20-5-3-2-4-6-20)17-38-27-24(26(32)30(25)27)29-15-18-7-11-21(12-8-18)31(34)35/h2-15,24,27H,16-17H2,1H3/b29-15+/t24-,27-/m1/s1 |
| InChIKey | ZZXQSRUOYGJKRZ-RWQIXVLVSA-N |
| XLogP | 4.46 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|