C30H25N3O8S — CID 22788657
(4-methoxyphenyl)methyl (6S,7R)-3-(4-methoxycarbonylphenyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 22788657) has the molecular formula C30H25N3O8S and a molecular weight of 587.61 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (6S,7R)-3-(4-methoxycarbonylphenyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (6S,7R)-3-(4-methoxycarbonylphenyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 22788657 |
| Molecular Formula | C30H25N3O8S |
| Molecular Weight | 587.61 g/mol |
| Exact Mass | 587.14 |
| IUPAC Name | (4-methoxyphenyl)methyl (6S,7R)-3-(4-methoxycarbonylphenyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COC(=O)c1ccc(C2=C(C(=O)OCc3ccc(OC)cc3)N3C(=O)[C@@H](/N=C/c4ccc([N+](=O)[O-])cc4)[C@@H]3SC2)cc1 |
| InChI | InChI=1S/C30H25N3O8S/c1-39-23-13-5-19(6-14-23)16-41-30(36)26-24(20-7-9-21(10-8-20)29(35)40-2)17-42-28-25(27(34)32(26)28)31-15-18-3-11-22(12-4-18)33(37)38/h3-15,25,28H,16-17H2,1-2H3/b31-15+/t25-,28+/m1/s1 |
| InChIKey | IBNHCOUYSSYZJV-FAVAOHFXSA-N |
| XLogP | 4.25 |
| TPSA | 137.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|