C29H22N4O6S — CID 22788666
(4-methoxyphenyl)methyl (6S,7S)-3-(4-cyanophenyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 22788666) has the molecular formula C29H22N4O6S and a molecular weight of 554.58 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (6S,7S)-3-(4-cyanophenyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (6S,7S)-3-(4-cyanophenyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 22788666 |
| Molecular Formula | C29H22N4O6S |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | (4-methoxyphenyl)methyl (6S,7S)-3-(4-cyanophenyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COc1ccc(COC(=O)C2=C(c3ccc(C#N)cc3)CS[C@H]3[C@@H](/N=C/c4ccc([N+](=O)[O-])cc4)C(=O)N23)cc1 |
| InChI | InChI=1S/C29H22N4O6S/c1-38-23-12-6-20(7-13-23)16-39-29(35)26-24(21-8-2-18(14-30)3-9-21)17-40-28-25(27(34)32(26)28)31-15-19-4-10-22(11-5-19)33(36)37/h2-13,15,25,28H,16-17H2,1H3/b31-15+/t25-,28-/m0/s1 |
| InChIKey | ZEFIQOZRGXVRJU-XISDMNPLSA-N |
| XLogP | 4.33 |
| TPSA | 135.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|