C27H30N4O10S2 — CID 88754397
4-methylbenzenesulfonic acid;(4-nitrophenyl)methyl (6R,7R)-3-(acetyloxymethyl)-7-(dimethylaminomethylideneamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88754397) has the molecular formula C27H30N4O10S2 and a molecular weight of 634.69 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;(4-nitrophenyl)methyl (6R,7R)-3-(acetyloxymethyl)-7-(dimethylaminomethylideneamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 4-methylbenzenesulfonic acid;(4-nitrophenyl)methyl (6R,7R)-3-(acetyloxymethyl)-7-(dimethylaminomethylideneamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88754397 |
| Molecular Formula | C27H30N4O10S2 |
| Molecular Weight | 634.69 g/mol |
| Exact Mass | 634.14 |
| IUPAC Name | 4-methylbenzenesulfonic acid;(4-nitrophenyl)methyl (6R,7R)-3-(acetyloxymethyl)-7-(dimethylaminomethylideneamino)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)[C@@H](/N=C/N(C)C)[C@H]2SC1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C20H22N4O7S.C7H8O3S/c1-12(25)30-9-14-10-32-19-16(21-11-22(2)3)18(26)23(19)17(14)20(27)31-8-13-4-6-15(7-5-13)24(28)29;1-6-2-4-7(5-3-6)11(8,9)10/h4-7,11,16,19H,8-10H2,1-3H3;2-5H,1H3,(H,8,9,10)/b21-11+;/t16-,19-;/m1./s1 |
| InChIKey | FMZPUZXZYWVAKU-CGUBTARRSA-N |
| XLogP | 2.57 |
| TPSA | 186.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.69 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|