C22H18N4O10S2 — CID 22798310
[(6S)-2-(4-nitrophenoxy)sulfonyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl acetate (PubChem CID 22798310) has the molecular formula C22H18N4O10S2 and a molecular weight of 562.54 g/mol. Its IUPAC name is [(6S)-2-(4-nitrophenoxy)sulfonyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl acetate.
| Compound Name | [(6S)-2-(4-nitrophenoxy)sulfonyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl acetate |
|---|---|
| PubChem CID | 22798310 |
| Molecular Formula | C22H18N4O10S2 |
| Molecular Weight | 562.54 g/mol |
| Exact Mass | 562.05 |
| IUPAC Name | [(6S)-2-(4-nitrophenoxy)sulfonyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C(S(=O)(=O)Oc2ccc([N+](=O)[O-])cc2)N2C(=O)C(/N=C/c3ccc([N+](=O)[O-])cc3)[C@@H]2SC1 |
| InChI | InChI=1S/C22H18N4O10S2/c1-13(27)35-11-15-12-37-21-19(23-10-14-2-4-16(5-3-14)25(29)30)20(28)24(21)22(15)38(33,34)36-18-8-6-17(7-9-18)26(31)32/h2-10,19,21H,11-12H2,1H3/b23-10+/t19?,21-/m0/s1 |
| InChIKey | NRFVVXKPNVRSCO-UYABPSSLSA-N |
| XLogP | 2.39 |
| TPSA | 188.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|