C32H27N3O9S — CID 70542023
benzhydryl (6R,7R)-7-acetyloxy-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70542023) has the molecular formula C32H27N3O9S and a molecular weight of 629.65 g/mol. Its IUPAC name is benzhydryl (6R,7R)-7-acetyloxy-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R,7R)-7-acetyloxy-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70542023 |
| Molecular Formula | C32H27N3O9S |
| Molecular Weight | 629.65 g/mol |
| Exact Mass | 629.15 |
| IUPAC Name | benzhydryl (6R,7R)-7-acetyloxy-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)[C@@](N=Cc3ccc([N+](=O)[O-])cc3)(OC(C)=O)[C@H]2SC1 |
| InChI | InChI=1S/C32H27N3O9S/c1-20(36)42-18-25-19-45-31-32(44-21(2)37,33-17-22-13-15-26(16-14-22)35(40)41)30(39)34(31)27(25)29(38)43-28(23-9-5-3-6-10-23)24-11-7-4-8-12-24/h3-17,28,31H,18-19H2,1-2H3/t31-,32-/m1/s1 |
| InChIKey | HUKIJQQBEGBUFH-ROJLCIKYSA-N |
| XLogP | 4.34 |
| TPSA | 154.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.65 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|