C34H33N3O6S2 — CID 88771394
benzhydryl (6R,7S)-3-(acetylsulfanylmethyl)-7-butyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88771394) has the molecular formula C34H33N3O6S2 and a molecular weight of 643.79 g/mol. Its IUPAC name is benzhydryl (6R,7S)-3-(acetylsulfanylmethyl)-7-butyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R,7S)-3-(acetylsulfanylmethyl)-7-butyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88771394 |
| Molecular Formula | C34H33N3O6S2 |
| Molecular Weight | 643.79 g/mol |
| Exact Mass | 643.18 |
| IUPAC Name | benzhydryl (6R,7S)-3-(acetylsulfanylmethyl)-7-butyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCCC[C@]1(/N=C/c2ccc([N+](=O)[O-])cc2)C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(CSC(C)=O)CS[C@@H]21 |
| InChI | InChI=1S/C34H33N3O6S2/c1-3-4-19-34(35-20-24-15-17-28(18-16-24)37(41)42)32(40)36-29(27(21-44-23(2)38)22-45-33(34)36)31(39)43-30(25-11-7-5-8-12-25)26-13-9-6-10-14-26/h5-18,20,30,33H,3-4,19,21-22H2,1-2H3/b35-20+/t33-,34+/m1/s1 |
| InChIKey | CMAKIXJRJSHOSS-ISYPMFAUSA-N |
| XLogP | 6.72 |
| TPSA | 119.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.79 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|