C25H25ClN2O7S — CID 22818092
benzhydryl (6R,7R)-7-acetyloxy-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride (PubChem CID 22818092) has the molecular formula C25H25ClN2O7S and a molecular weight of 533.00 g/mol. Its IUPAC name is benzhydryl (6R,7R)-7-acetyloxy-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride.
| Compound Name | benzhydryl (6R,7R)-7-acetyloxy-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 22818092 |
| Molecular Formula | C25H25ClN2O7S |
| Molecular Weight | 533.00 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | benzhydryl (6R,7R)-7-acetyloxy-3-(acetyloxymethyl)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate;hydrochloride |
| SMILES | CC(=O)OCC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)[C@@](N)(OC(C)=O)[C@H]2SC1.Cl |
| InChI | InChI=1S/C25H24N2O7S.ClH/c1-15(28)32-13-19-14-35-24-25(26,34-16(2)29)23(31)27(24)20(19)22(30)33-21(17-9-5-3-6-10-17)18-11-7-4-8-12-18;/h3-12,21,24H,13-14,26H2,1-2H3;1H/t24-,25-;/m1./s1 |
| InChIKey | FNZQRFQOCRVMGA-JIMLSGQQSA-N |
| XLogP | 2.69 |
| TPSA | 125.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.00 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|