C31H27N3O8S — CID 22817944
benzhydryl (6R,7R)-3-(acetyloxymethyl)-7-(hydroxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 22817944) has the molecular formula C31H27N3O8S and a molecular weight of 601.64 g/mol. Its IUPAC name is benzhydryl (6R,7R)-3-(acetyloxymethyl)-7-(hydroxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R,7R)-3-(acetyloxymethyl)-7-(hydroxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 22817944 |
| Molecular Formula | C31H27N3O8S |
| Molecular Weight | 601.64 g/mol |
| Exact Mass | 601.15 |
| IUPAC Name | benzhydryl (6R,7R)-3-(acetyloxymethyl)-7-(hydroxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)[C@@](CO)(/N=C/c3ccc([N+](=O)[O-])cc3)[C@H]2SC1 |
| InChI | InChI=1S/C31H27N3O8S/c1-20(36)41-17-24-18-43-30-31(19-35,32-16-21-12-14-25(15-13-21)34(39)40)29(38)33(30)26(24)28(37)42-27(22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-16,27,30,35H,17-19H2,1H3/b32-16+/t30-,31-/m1/s1 |
| InChIKey | SUWNAEHZKFROSC-GWDARDDLSA-N |
| XLogP | 3.81 |
| TPSA | 148.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|