C33H29N3O9S — CID 70541263
2-O-benzhydryl 7-O-ethyl (6R,7R)-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,7-dicarboxylate (PubChem CID 70541263) has the molecular formula C33H29N3O9S and a molecular weight of 643.67 g/mol. Its IUPAC name is 2-O-benzhydryl 7-O-ethyl (6R,7R)-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,7-dicarboxylate.
| Compound Name | 2-O-benzhydryl 7-O-ethyl (6R,7R)-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,7-dicarboxylate |
|---|---|
| PubChem CID | 70541263 |
| Molecular Formula | C33H29N3O9S |
| Molecular Weight | 643.67 g/mol |
| Exact Mass | 643.16 |
| IUPAC Name | 2-O-benzhydryl 7-O-ethyl (6R,7R)-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2,7-dicarboxylate |
| SMILES | CCOC(=O)[C@]1(/N=C/c2ccc([N+](=O)[O-])cc2)C(=O)N2C(C(=O)OC(c3ccccc3)c3ccccc3)=C(COC(C)=O)CS[C@@H]21 |
| InChI | InChI=1S/C33H29N3O9S/c1-3-43-32(40)33(34-18-22-14-16-26(17-15-22)36(41)42)30(39)35-27(25(19-44-21(2)37)20-46-31(33)35)29(38)45-28(23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-18,28,31H,3,19-20H2,1-2H3/b34-18+/t31-,33+/m1/s1 |
| InChIKey | WAQNRINLJWOHHS-XXMFCBOHSA-N |
| XLogP | 4.38 |
| TPSA | 154.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.67 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|