C37H31N3O7S — CID 54124184
benzhydryl (6R)-3-(acetyloxymethyl)-7-benzyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54124184) has the molecular formula C37H31N3O7S and a molecular weight of 661.74 g/mol. Its IUPAC name is benzhydryl (6R)-3-(acetyloxymethyl)-7-benzyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-3-(acetyloxymethyl)-7-benzyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54124184 |
| Molecular Formula | C37H31N3O7S |
| Molecular Weight | 661.74 g/mol |
| Exact Mass | 661.19 |
| IUPAC Name | benzhydryl (6R)-3-(acetyloxymethyl)-7-benzyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(Cc3ccccc3)(/N=C/c3ccc([N+](=O)[O-])cc3)[C@H]2SC1 |
| InChI | InChI=1S/C37H31N3O7S/c1-25(41)46-23-30-24-48-36-37(21-26-11-5-2-6-12-26,38-22-27-17-19-31(20-18-27)40(44)45)35(43)39(36)32(30)34(42)47-33(28-13-7-3-8-14-28)29-15-9-4-10-16-29/h2-20,22,33,36H,21,23-24H2,1H3/b38-22+/t36-,37?/m1/s1 |
| InChIKey | NPUYMAGAMQZXQT-GFTGNCFESA-N |
| XLogP | 6.06 |
| TPSA | 128.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.74 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|