C31H27N3O6S2 — CID 54091610
benzhydryl (6R)-3-(acetylsulfanylmethyl)-7-methyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54091610) has the molecular formula C31H27N3O6S2 and a molecular weight of 601.71 g/mol. Its IUPAC name is benzhydryl (6R)-3-(acetylsulfanylmethyl)-7-methyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-3-(acetylsulfanylmethyl)-7-methyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54091610 |
| Molecular Formula | C31H27N3O6S2 |
| Molecular Weight | 601.71 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | benzhydryl (6R)-3-(acetylsulfanylmethyl)-7-methyl-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)SCC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(C)(/N=C/c3ccc([N+](=O)[O-])cc3)[C@H]2SC1 |
| InChI | InChI=1S/C31H27N3O6S2/c1-20(35)41-18-24-19-42-30-31(2,32-17-21-13-15-25(16-14-21)34(38)39)29(37)33(30)26(24)28(36)40-27(22-9-5-3-6-10-22)23-11-7-4-8-12-23/h3-17,27,30H,18-19H2,1-2H3/b32-17+/t30-,31?/m1/s1 |
| InChIKey | MUGFORZHDZJOHS-XCWCRCHQSA-N |
| XLogP | 5.55 |
| TPSA | 119.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.71 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|