C30H26N4O9S2 — CID 54297926
benzhydryl (6R)-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-7-sulfamoyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54297926) has the molecular formula C30H26N4O9S2 and a molecular weight of 650.69 g/mol. Its IUPAC name is benzhydryl (6R)-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-7-sulfamoyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | benzhydryl (6R)-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-7-sulfamoyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54297926 |
| Molecular Formula | C30H26N4O9S2 |
| Molecular Weight | 650.69 g/mol |
| Exact Mass | 650.11 |
| IUPAC Name | benzhydryl (6R)-3-(acetyloxymethyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-7-sulfamoyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC(=O)OCC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(N=Cc3ccc([N+](=O)[O-])cc3)(S(N)(=O)=O)[C@H]2SC1 |
| InChI | InChI=1S/C30H26N4O9S2/c1-19(35)42-17-23-18-44-29-30(45(31,40)41,32-16-20-12-14-24(15-13-20)34(38)39)28(37)33(29)25(23)27(36)43-26(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-16,26,29H,17-18H2,1H3,(H2,31,40,41)/t29-,30?/m1/s1 |
| InChIKey | SCBXSMQCVIEKNJ-IDCGIGBZSA-N |
| XLogP | 3.06 |
| TPSA | 188.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.69 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|