C22H20N4O10S2 — CID 88795168
(6R)-3-(acetyloxymethyl)-4-(4-nitrophenyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-sulfonic acid (PubChem CID 88795168) has the molecular formula C22H20N4O10S2 and a molecular weight of 564.55 g/mol. Its IUPAC name is (6R)-3-(acetyloxymethyl)-4-(4-nitrophenyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-sulfonic acid.
| Compound Name | (6R)-3-(acetyloxymethyl)-4-(4-nitrophenyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-sulfonic acid |
|---|---|
| PubChem CID | 88795168 |
| Molecular Formula | C22H20N4O10S2 |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 564.06 |
| IUPAC Name | (6R)-3-(acetyloxymethyl)-4-(4-nitrophenyl)-7-[(4-nitrophenyl)methylideneamino]-8-oxo-5-thia-1-azabicyclo[4.2.0]octane-3-sulfonic acid |
| SMILES | CC(=O)OCC1(S(=O)(=O)O)CN2C(=O)C(/N=C/c3ccc([N+](=O)[O-])cc3)[C@H]2SC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H20N4O10S2/c1-13(27)36-12-22(38(33,34)35)11-24-20(28)18(23-10-14-2-6-16(7-3-14)25(29)30)21(24)37-19(22)15-4-8-17(9-5-15)26(31)32/h2-10,18-19,21H,11-12H2,1H3,(H,33,34,35)/b23-10+/t18?,19?,21-,22?/m1/s1 |
| InChIKey | YHOPPMWEZORRQG-DJZWROIUSA-N |
| XLogP | 2.14 |
| TPSA | 199.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|