C25H23ClN2O4S — CID 70294955
(4-methoxyphenyl)methyl (6R,7R)-7-(benzylideneamino)-3-[(Z)-3-chloroprop-1-enyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70294955) has the molecular formula C25H23ClN2O4S and a molecular weight of 482.99 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (6R,7R)-7-(benzylideneamino)-3-[(Z)-3-chloroprop-1-enyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (6R,7R)-7-(benzylideneamino)-3-[(Z)-3-chloroprop-1-enyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70294955 |
| Molecular Formula | C25H23ClN2O4S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | (4-methoxyphenyl)methyl (6R,7R)-7-(benzylideneamino)-3-[(Z)-3-chloroprop-1-enyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | COc1ccc(COC(=O)C2=C(/C=C\CCl)CS[C@@H]3[C@H](/N=C/c4ccccc4)C(=O)N23)cc1 |
| InChI | InChI=1S/C25H23ClN2O4S/c1-31-20-11-9-18(10-12-20)15-32-25(30)22-19(8-5-13-26)16-33-24-21(23(29)28(22)24)27-14-17-6-3-2-4-7-17/h2-12,14,21,24H,13,15-16H2,1H3/b8-5-,27-14+/t21-,24-/m1/s1 |
| InChIKey | ATUDTGZHRNZOLL-FYOVIVIYSA-N |
| XLogP | 4.19 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|