C30H28ClFN2O6S2 — CID 139603780
(4-methoxyphenyl)methyl 3-(chloromethyl)-2-[3-[(4-fluorophenyl)methylideneamino]-2-(4-methylphenyl)sulfonylsulfanyl-4-oxoazetidin-1-yl]but-3-enoate (PubChem CID 139603780) has the molecular formula C30H28ClFN2O6S2 and a molecular weight of 631.15 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 3-(chloromethyl)-2-[3-[(4-fluorophenyl)methylideneamino]-2-(4-methylphenyl)sulfonylsulfanyl-4-oxoazetidin-1-yl]but-3-enoate.
| Compound Name | (4-methoxyphenyl)methyl 3-(chloromethyl)-2-[3-[(4-fluorophenyl)methylideneamino]-2-(4-methylphenyl)sulfonylsulfanyl-4-oxoazetidin-1-yl]but-3-enoate |
|---|---|
| PubChem CID | 139603780 |
| Molecular Formula | C30H28ClFN2O6S2 |
| Molecular Weight | 631.15 g/mol |
| Exact Mass | 630.11 |
| IUPAC Name | (4-methoxyphenyl)methyl 3-(chloromethyl)-2-[3-[(4-fluorophenyl)methylideneamino]-2-(4-methylphenyl)sulfonylsulfanyl-4-oxoazetidin-1-yl]but-3-enoate |
| SMILES | C=C(CCl)C(C(=O)OCc1ccc(OC)cc1)N1C(=O)C(/N=C/c2ccc(F)cc2)C1SS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H28ClFN2O6S2/c1-19-4-14-25(15-5-19)42(37,38)41-29-26(33-17-21-6-10-23(32)11-7-21)28(35)34(29)27(20(2)16-31)30(36)40-18-22-8-12-24(39-3)13-9-22/h4-15,17,26-27,29H,2,16,18H2,1,3H3/b33-17+ |
| InChIKey | VAGWYFURSVZJEL-ATZGPIRCSA-N |
| XLogP | 5.13 |
| TPSA | 102.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.15 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|