C29H25Cl3N2O6S2 — CID 139603768
(4-methoxyphenyl)methyl 2-[2-(benzenesulfonylsulfanyl)-3-[(2,4-dichlorophenyl)methylideneamino]-4-oxoazetidin-1-yl]-3-(chloromethyl)but-3-enoate (PubChem CID 139603768) has the molecular formula C29H25Cl3N2O6S2 and a molecular weight of 668.02 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 2-[2-(benzenesulfonylsulfanyl)-3-[(2,4-dichlorophenyl)methylideneamino]-4-oxoazetidin-1-yl]-3-(chloromethyl)but-3-enoate.
| Compound Name | (4-methoxyphenyl)methyl 2-[2-(benzenesulfonylsulfanyl)-3-[(2,4-dichlorophenyl)methylideneamino]-4-oxoazetidin-1-yl]-3-(chloromethyl)but-3-enoate |
|---|---|
| PubChem CID | 139603768 |
| Molecular Formula | C29H25Cl3N2O6S2 |
| Molecular Weight | 668.02 g/mol |
| Exact Mass | 666.02 |
| IUPAC Name | (4-methoxyphenyl)methyl 2-[2-(benzenesulfonylsulfanyl)-3-[(2,4-dichlorophenyl)methylideneamino]-4-oxoazetidin-1-yl]-3-(chloromethyl)but-3-enoate |
| SMILES | C=C(CCl)C(C(=O)OCc1ccc(OC)cc1)N1C(=O)C(/N=C/c2ccc(Cl)cc2Cl)C1SS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H25Cl3N2O6S2/c1-18(15-30)26(29(36)40-17-19-8-12-22(39-2)13-9-19)34-27(35)25(33-16-20-10-11-21(31)14-24(20)32)28(34)41-42(37,38)23-6-4-3-5-7-23/h3-14,16,25-26,28H,1,15,17H2,2H3/b33-16+ |
| InChIKey | LXWQXRNTWLLQOP-MHDJOFBISA-N |
| XLogP | 5.99 |
| TPSA | 102.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.02 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|