C36H33ClN2O10S3 — CID 10509480
(4-methoxyphenyl)methyl (Z)-2-[(2R,3R)-2-(benzenesulfonylsulfanyl)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-4-chloro-3-(4-methylphenyl)sulfonyloxybut-2-enoate (PubChem CID 10509480) has the molecular formula C36H33ClN2O10S3 and a molecular weight of 785.32 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (Z)-2-[(2R,3R)-2-(benzenesulfonylsulfanyl)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-4-chloro-3-(4-methylphenyl)sulfonyloxybut-2-enoate.
| Compound Name | (4-methoxyphenyl)methyl (Z)-2-[(2R,3R)-2-(benzenesulfonylsulfanyl)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-4-chloro-3-(4-methylphenyl)sulfonyloxybut-2-enoate |
|---|---|
| PubChem CID | 10509480 |
| Molecular Formula | C36H33ClN2O10S3 |
| Molecular Weight | 785.32 g/mol |
| Exact Mass | 784.10 |
| IUPAC Name | (4-methoxyphenyl)methyl (Z)-2-[(2R,3R)-2-(benzenesulfonylsulfanyl)-4-oxo-3-[(2-phenylacetyl)amino]azetidin-1-yl]-4-chloro-3-(4-methylphenyl)sulfonyloxybut-2-enoate |
| SMILES | COc1ccc(COC(=O)/C(=C(\CCl)OS(=O)(=O)c2ccc(C)cc2)N2C(=O)[C@@H](NC(=O)Cc3ccccc3)[C@H]2SS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H33ClN2O10S3/c1-24-13-19-28(20-14-24)51(43,44)49-30(22-37)33(36(42)48-23-26-15-17-27(47-2)18-16-26)39-34(41)32(38-31(40)21-25-9-5-3-6-10-25)35(39)50-52(45,46)29-11-7-4-8-12-29/h3-20,32,35H,21-23H2,1-2H3,(H,38,40)/b33-30-/t32-,35-/m1/s1 |
| InChIKey | IRWCMPOEGIRVEC-GPJNDFSYSA-N |
| XLogP | 4.92 |
| TPSA | 162.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.32 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|