C17H16N2O6S — CID 134927906
methyl (2R)-2-[(2R,3R)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxysulfanyl-4-oxoazetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 134927906) has the molecular formula C17H16N2O6S and a molecular weight of 376.39 g/mol. Its IUPAC name is methyl (2R)-2-[(2R,3R)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxysulfanyl-4-oxoazetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | methyl (2R)-2-[(2R,3R)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxysulfanyl-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 134927906 |
| Molecular Formula | C17H16N2O6S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | methyl (2R)-2-[(2R,3R)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxysulfanyl-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)[C@H](C(=O)OC)N1C(=O)[C@@H](N2C(=O)c3ccccc3C2=O)[C@H]1SO |
| InChI | InChI=1S/C17H16N2O6S/c1-8(2)11(17(23)25-3)19-15(22)12(16(19)26-24)18-13(20)9-6-4-5-7-10(9)14(18)21/h4-7,11-12,16,24H,1H2,2-3H3/t11-,12-,16-/m1/s1 |
| InChIKey | AXGCBBIKUGSQGJ-XHBSWPGZSA-N |
| XLogP | 1.14 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|