C29H24N2O6S — CID 15406088
benzhydryl (2R)-2-[(2S,3S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxysulfanyl-4-oxoazetidin-1-yl]-3-methylbut-3-enoate (PubChem CID 15406088) has the molecular formula C29H24N2O6S and a molecular weight of 528.59 g/mol. Its IUPAC name is benzhydryl (2R)-2-[(2S,3S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxysulfanyl-4-oxoazetidin-1-yl]-3-methylbut-3-enoate.
| Compound Name | benzhydryl (2R)-2-[(2S,3S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxysulfanyl-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
|---|---|
| PubChem CID | 15406088 |
| Molecular Formula | C29H24N2O6S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | benzhydryl (2R)-2-[(2S,3S)-3-(1,3-dioxoisoindol-2-yl)-2-hydroxysulfanyl-4-oxoazetidin-1-yl]-3-methylbut-3-enoate |
| SMILES | C=C(C)[C@H](C(=O)OC(c1ccccc1)c1ccccc1)N1C(=O)[C@H](N2C(=O)c3ccccc3C2=O)[C@@H]1SO |
| InChI | InChI=1S/C29H24N2O6S/c1-17(2)22(29(35)37-24(18-11-5-3-6-12-18)19-13-7-4-8-14-19)31-27(34)23(28(31)38-36)30-25(32)20-15-9-10-16-21(20)26(30)33/h3-16,22-24,28,36H,1H2,2H3/t22-,23+,28+/m1/s1 |
| InChIKey | IDUDWWMPJLGJFI-IWHLBADBSA-N |
| XLogP | 4.30 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|