C29H24N2O7 — CID 70596656
benzhydryl (2R,4S)-7-(1,3-dioxoisoindol-2-yl)-4-methoxy-8-oxo-3-oxa-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 70596656) has the molecular formula C29H24N2O7 and a molecular weight of 512.52 g/mol. Its IUPAC name is benzhydryl (2R,4S)-7-(1,3-dioxoisoindol-2-yl)-4-methoxy-8-oxo-3-oxa-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | benzhydryl (2R,4S)-7-(1,3-dioxoisoindol-2-yl)-4-methoxy-8-oxo-3-oxa-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 70596656 |
| Molecular Formula | C29H24N2O7 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | benzhydryl (2R,4S)-7-(1,3-dioxoisoindol-2-yl)-4-methoxy-8-oxo-3-oxa-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | CO[C@@H]1CC2C(N3C(=O)c4ccccc4C3=O)C(=O)N2[C@@H](C(=O)OC(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C29H24N2O7/c1-36-22-16-21-23(31-25(32)19-14-8-9-15-20(19)26(31)33)27(34)30(21)28(37-22)29(35)38-24(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-15,21-24,28H,16H2,1H3/t21?,22-,23?,28+/m0/s1 |
| InChIKey | VVHCMLYHZLLRAY-WWHCGVQESA-N |
| XLogP | 2.91 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|