C17H14N2O6S — CID 22799572
methyl (6S)-7-(1,3-dioxoisoindol-2-yl)-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate (PubChem CID 22799572) has the molecular formula C17H14N2O6S and a molecular weight of 374.37 g/mol. Its IUPAC name is methyl (6S)-7-(1,3-dioxoisoindol-2-yl)-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate.
| Compound Name | methyl (6S)-7-(1,3-dioxoisoindol-2-yl)-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
|---|---|
| PubChem CID | 22799572 |
| Molecular Formula | C17H14N2O6S |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | methyl (6S)-7-(1,3-dioxoisoindol-2-yl)-3-methylidene-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]octane-2-carboxylate |
| SMILES | C=C1CS(=O)[C@H]2C(N3C(=O)c4ccccc4C3=O)C(=O)N2C1C(=O)OC |
| InChI | InChI=1S/C17H14N2O6S/c1-8-7-26(24)16-12(15(22)19(16)11(8)17(23)25-2)18-13(20)9-5-3-4-6-10(9)14(18)21/h3-6,11-12,16H,1,7H2,2H3/t11?,12?,16-,26?/m0/s1 |
| InChIKey | KWNKLOIQBJJEKH-QVPRHAJMSA-N |
| XLogP | -0.32 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|