C17H15ClN2O5S — CID 70623274
methyl (3R,5R)-3-(chloromethyl)-6-(1,3-dioxoisoindol-2-yl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70623274) has the molecular formula C17H15ClN2O5S and a molecular weight of 394.84 g/mol. Its IUPAC name is methyl (3R,5R)-3-(chloromethyl)-6-(1,3-dioxoisoindol-2-yl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | methyl (3R,5R)-3-(chloromethyl)-6-(1,3-dioxoisoindol-2-yl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70623274 |
| Molecular Formula | C17H15ClN2O5S |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | methyl (3R,5R)-3-(chloromethyl)-6-(1,3-dioxoisoindol-2-yl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COC(=O)C1N2C(=O)C(N3C(=O)c4ccccc4C3=O)[C@H]2S[C@@]1(C)CCl |
| InChI | InChI=1S/C17H15ClN2O5S/c1-17(7-18)11(16(24)25-2)20-14(23)10(15(20)26-17)19-12(21)8-5-3-4-6-9(8)13(19)22/h3-6,10-11,15H,7H2,1-2H3/t10?,11?,15-,17+/m1/s1 |
| InChIKey | AVDKFZUBBNGYCB-WZNFMNEHSA-N |
| XLogP | 1.11 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|