C25H23N3O10S — CID 22790766
(4-methoxyphenyl)methyl (3R,5S)-6-(4-methoxy-1,3-dioxoisoindol-2-yl)-3-methyl-3-(nitrooxymethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 22790766) has the molecular formula C25H23N3O10S and a molecular weight of 557.54 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl (3R,5S)-6-(4-methoxy-1,3-dioxoisoindol-2-yl)-3-methyl-3-(nitrooxymethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-methoxyphenyl)methyl (3R,5S)-6-(4-methoxy-1,3-dioxoisoindol-2-yl)-3-methyl-3-(nitrooxymethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 22790766 |
| Molecular Formula | C25H23N3O10S |
| Molecular Weight | 557.54 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | (4-methoxyphenyl)methyl (3R,5S)-6-(4-methoxy-1,3-dioxoisoindol-2-yl)-3-methyl-3-(nitrooxymethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | COc1ccc(COC(=O)C2N3C(=O)C(N4C(=O)c5cccc(OC)c5C4=O)[C@@H]3S[C@@]2(C)CO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H23N3O10S/c1-25(12-38-28(33)34)19(24(32)37-11-13-7-9-14(35-2)10-8-13)27-22(31)18(23(27)39-25)26-20(29)15-5-4-6-16(36-3)17(15)21(26)30/h4-10,18-19,23H,11-12H2,1-3H3/t18?,19?,23-,25-/m0/s1 |
| InChIKey | OIFDLXYJEJDZSA-INLZHIODSA-N |
| XLogP | 1.66 |
| TPSA | 154.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|