C27H26N4O10S — CID 88829509
(4-nitrophenyl)methyl (3R,5R)-3-methyl-3-(nitrooxymethyl)-7-oxo-6-(4,5,6,7-tetramethyl-1,3-dioxoisoindol-2-yl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 88829509) has the molecular formula C27H26N4O10S and a molecular weight of 598.59 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (3R,5R)-3-methyl-3-(nitrooxymethyl)-7-oxo-6-(4,5,6,7-tetramethyl-1,3-dioxoisoindol-2-yl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (3R,5R)-3-methyl-3-(nitrooxymethyl)-7-oxo-6-(4,5,6,7-tetramethyl-1,3-dioxoisoindol-2-yl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 88829509 |
| Molecular Formula | C27H26N4O10S |
| Molecular Weight | 598.59 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | (4-nitrophenyl)methyl (3R,5R)-3-methyl-3-(nitrooxymethyl)-7-oxo-6-(4,5,6,7-tetramethyl-1,3-dioxoisoindol-2-yl)-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | Cc1c(C)c(C)c2c(c1C)C(=O)N(C1C(=O)N3C(C(=O)OCc4ccc([N+](=O)[O-])cc4)[C@](C)(CO[N+](=O)[O-])S[C@H]13)C2=O |
| InChI | InChI=1S/C27H26N4O10S/c1-12-13(2)15(4)19-18(14(12)3)22(32)28(23(19)33)20-24(34)29-21(27(5,42-25(20)29)11-41-31(38)39)26(35)40-10-16-6-8-17(9-7-16)30(36)37/h6-9,20-21,25H,10-11H2,1-5H3/t20?,21?,25-,27+/m1/s1 |
| InChIKey | HPYRKPUKZKDKBD-YXUQEFPKSA-N |
| XLogP | 2.79 |
| TPSA | 179.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.59 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|