C23H19N3O8S — CID 70610277
(4-nitrophenyl)methyl (5R,6R)-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 70610277) has the molecular formula C23H19N3O8S and a molecular weight of 497.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (5R,6R)-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (5R,6R)-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 70610277 |
| Molecular Formula | C23H19N3O8S |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 497.09 |
| IUPAC Name | (4-nitrophenyl)methyl (5R,6R)-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-4,7-dioxo-4λ4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC1(C)C(C(=O)OCc2ccc([N+](=O)[O-])cc2)N2C(=O)[C@@H](N3C(=O)c4ccccc4C3=O)[C@H]2S1=O |
| InChI | InChI=1S/C23H19N3O8S/c1-23(2)17(22(30)34-11-12-7-9-13(10-8-12)26(31)32)25-20(29)16(21(25)35(23)33)24-18(27)14-5-3-4-6-15(14)19(24)28/h3-10,16-17,21H,11H2,1-2H3/t16-,17?,21-,35?/m1/s1 |
| InChIKey | FSLFXEDHDYJXEO-CHYUBBTESA-N |
| XLogP | 1.38 |
| TPSA | 144.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|