C20H19N3O10S — CID 22790739
acetyloxymethyl (3R,5S)-3-methyl-6-(4-methyl-1,3-dioxoisoindol-2-yl)-3-(nitrooxymethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate (PubChem CID 22790739) has the molecular formula C20H19N3O10S and a molecular weight of 493.45 g/mol. Its IUPAC name is acetyloxymethyl (3R,5S)-3-methyl-6-(4-methyl-1,3-dioxoisoindol-2-yl)-3-(nitrooxymethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate.
| Compound Name | acetyloxymethyl (3R,5S)-3-methyl-6-(4-methyl-1,3-dioxoisoindol-2-yl)-3-(nitrooxymethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
|---|---|
| PubChem CID | 22790739 |
| Molecular Formula | C20H19N3O10S |
| Molecular Weight | 493.45 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | acetyloxymethyl (3R,5S)-3-methyl-6-(4-methyl-1,3-dioxoisoindol-2-yl)-3-(nitrooxymethyl)-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate |
| SMILES | CC(=O)OCOC(=O)C1N2C(=O)C(N3C(=O)c4cccc(C)c4C3=O)[C@@H]2S[C@@]1(C)CO[N+](=O)[O-] |
| InChI | InChI=1S/C20H19N3O10S/c1-9-5-4-6-11-12(9)16(26)21(15(11)25)13-17(27)22-14(19(28)32-8-31-10(2)24)20(3,34-18(13)22)7-33-23(29)30/h4-6,13-14,18H,7-8H2,1-3H3/t13?,14?,18-,20-/m0/s1 |
| InChIKey | XZGLIZOUMZIVDE-GUBQMWQZSA-N |
| XLogP | 0.27 |
| TPSA | 162.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.45 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|