C23H21N3O4S — CID 46887754
(2S,5R,6R)-N-benzyl-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxamide (PubChem CID 46887754) has the molecular formula C23H21N3O4S and a molecular weight of 435.51 g/mol. Its IUPAC name is (2S,5R,6R)-N-benzyl-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxamide.
| Compound Name | (2S,5R,6R)-N-benzyl-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxamide |
|---|---|
| PubChem CID | 46887754 |
| Molecular Formula | C23H21N3O4S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | (2S,5R,6R)-N-benzyl-6-(1,3-dioxoisoindol-2-yl)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxamide |
| SMILES | CC1(C)S[C@@H]2[C@H](N3C(=O)c4ccccc4C3=O)C(=O)N2[C@H]1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H21N3O4S/c1-23(2)17(18(27)24-12-13-8-4-3-5-9-13)26-21(30)16(22(26)31-23)25-19(28)14-10-6-7-11-15(14)20(25)29/h3-11,16-17,22H,12H2,1-2H3,(H,24,27)/t16-,17+,22-/m1/s1 |
| InChIKey | IOIZJJAYUVTSQN-HYFFOGBASA-N |
| XLogP | 2.03 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|