C22H33N4O4S+ — CID 76685233
[(2S,5R,6R)-6-(benzylcarbamoylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxy-triethylazanium (PubChem CID 76685233) has the molecular formula C22H33N4O4S+ and a molecular weight of 449.60 g/mol. Its IUPAC name is [(2S,5R,6R)-6-(benzylcarbamoylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxy-triethylazanium.
| Compound Name | [(2S,5R,6R)-6-(benzylcarbamoylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxy-triethylazanium |
|---|---|
| PubChem CID | 76685233 |
| Molecular Formula | C22H33N4O4S+ |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | [(2S,5R,6R)-6-(benzylcarbamoylamino)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]oxy-triethylazanium |
| SMILES | CC[N+](CC)(CC)OC(=O)[C@@H]1N2C(=O)[C@@H](NC(=O)NCc3ccccc3)[C@H]2SC1(C)C |
| InChI | InChI=1S/C22H32N4O4S/c1-6-26(7-2,8-3)30-20(28)17-22(4,5)31-19-16(18(27)25(17)19)24-21(29)23-14-15-12-10-9-11-13-15/h9-13,16-17,19H,6-8,14H2,1-5H3,(H-,23,24,29)/p+1/t16-,17+,19-/m1/s1 |
| InChIKey | CBSIVJGZRATIBU-ZIFCJYIRSA-O |
| XLogP | 2.25 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|